C13H25N3O4 — CID 154824368
[[1-amino-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butylidene]amino] acetate (PubChem CID 154824368) has the molecular formula C13H25N3O4 and a molecular weight of 287.36 g/mol. Its IUPAC name is [[1-amino-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butylidene]amino] acetate.
| Compound Name | [[1-amino-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butylidene]amino] acetate |
|---|---|
| PubChem CID | 154824368 |
| Molecular Formula | C13H25N3O4 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | [[1-amino-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butylidene]amino] acetate |
| SMILES | CC(=O)ON=C(N)C(NC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H25N3O4/c1-8(17)20-16-10(14)9(12(2,3)4)15-11(18)19-13(5,6)7/h9H,1-7H3,(H2,14,16)(H,15,18) |
| InChIKey | PADCYJSJCACFRX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|