C11H23N3O2 — CID 61429987
tert-butyl N-(1-amino-1-imino-3,3-dimethylbutan-2-yl)carbamate (PubChem CID 61429987) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is tert-butyl N-(1-amino-1-imino-3,3-dimethylbutan-2-yl)carbamate.
| Compound Name | tert-butyl N-(1-amino-1-imino-3,3-dimethylbutan-2-yl)carbamate |
|---|---|
| PubChem CID | 61429987 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | tert-butyl N-(1-amino-1-imino-3,3-dimethylbutan-2-yl)carbamate |
| SMILES | [H]/N=C(\N)C(NC(=O)OC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H23N3O2/c1-10(2,3)7(8(12)13)14-9(15)16-11(4,5)6/h7H,1-6H3,(H3,12,13)(H,14,15) |
| InChIKey | WDACXJOFTRPCLP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|