C9H19N3O2 — CID 61430621
tert-butyl N-(4-amino-4-iminobutyl)carbamate (PubChem CID 61430621) has the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. Its IUPAC name is tert-butyl N-(4-amino-4-iminobutyl)carbamate.
| Compound Name | tert-butyl N-(4-amino-4-iminobutyl)carbamate |
|---|---|
| PubChem CID | 61430621 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | tert-butyl N-(4-amino-4-iminobutyl)carbamate |
| SMILES | [H]/N=C(\N)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H19N3O2/c1-9(2,3)14-8(13)12-6-4-5-7(10)11/h4-6H2,1-3H3,(H3,10,11)(H,12,13) |
| InChIKey | XXISVYRSBDNLOV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|