C18H23BN2O3 — CID 123914478
CID 123914478 (PubChem CID 123914478) has the molecular formula C18H23BN2O3 and a molecular weight of 326.20 g/mol.
| Compound Name | CID 123914478 |
|---|---|
| PubChem CID | 123914478 |
| Molecular Formula | C18H23BN2O3 |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | — |
| SMILES | [B]CCCC1CN(C(=O)C2Cc3ccccc3CN2)CC1C(=O)O |
| InChI | InChI=1S/C18H23BN2O3/c19-7-3-6-14-10-21(11-15(14)18(23)24)17(22)16-8-12-4-1-2-5-13(12)9-20-16/h1-2,4-5,14-16,20H,3,6-11H2,(H,23,24) |
| InChIKey | BUKZIANPNQSKOG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|