C18H25BN2O2 — CID 123616520
CID 123616520 (PubChem CID 123616520) has the molecular formula C18H25BN2O2 and a molecular weight of 312.22 g/mol.
| Compound Name | CID 123616520 |
|---|---|
| PubChem CID | 123616520 |
| Molecular Formula | C18H25BN2O2 |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | — |
| SMILES | [B]CCCC1CN(CC2Cc3ccccc3CN2)CC1C(=O)O |
| InChI | InChI=1S/C18H25BN2O2/c19-7-3-6-15-10-21(12-17(15)18(22)23)11-16-8-13-4-1-2-5-14(13)9-20-16/h1-2,4-5,15-17,20H,3,6-12H2,(H,22,23) |
| InChIKey | ZEMZWNBKPXVUMQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|