C15H23N3O2S — CID 174730934
[4-[[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]piperazin-1-yl]methanesulfinic acid (PubChem CID 174730934) has the molecular formula C15H23N3O2S and a molecular weight of 309.43 g/mol. Its IUPAC name is [4-[[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]piperazin-1-yl]methanesulfinic acid.
| Compound Name | [4-[[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]piperazin-1-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 174730934 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | [4-[[(3S)-1,2,3,4-tetrahydroisoquinolin-3-yl]methyl]piperazin-1-yl]methanesulfinic acid |
| SMILES | O=S(O)CN1CCN(C[C@@H]2Cc3ccccc3CN2)CC1 |
| InChI | InChI=1S/C15H23N3O2S/c19-21(20)12-18-7-5-17(6-8-18)11-15-9-13-3-1-2-4-14(13)10-16-15/h1-4,15-16H,5-12H2,(H,19,20)/t15-/m0/s1 |
| InChIKey | FPBBBZONWPUBQW-HNNXBMFYSA-N |
| XLogP | 0.50 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|