C17H24ClFN2O — CID 123915044
4-chloro-2-(fluoromethyl)-N-(3-methyl-1-pyrrolidin-1-ylbutan-2-yl)benzamide (PubChem CID 123915044) has the molecular formula C17H24ClFN2O and a molecular weight of 326.84 g/mol. Its IUPAC name is 4-chloro-2-(fluoromethyl)-N-(3-methyl-1-pyrrolidin-1-ylbutan-2-yl)benzamide.
| Compound Name | 4-chloro-2-(fluoromethyl)-N-(3-methyl-1-pyrrolidin-1-ylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 123915044 |
| Molecular Formula | C17H24ClFN2O |
| Molecular Weight | 326.84 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 4-chloro-2-(fluoromethyl)-N-(3-methyl-1-pyrrolidin-1-ylbutan-2-yl)benzamide |
| SMILES | CC(C)C(CN1CCCC1)NC(=O)c1ccc(Cl)cc1CF |
| InChI | InChI=1S/C17H24ClFN2O/c1-12(2)16(11-21-7-3-4-8-21)20-17(22)15-6-5-14(18)9-13(15)10-19/h5-6,9,12,16H,3-4,7-8,10-11H2,1-2H3,(H,20,22) |
| InChIKey | ISCLXCNJBXSMRR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.84 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |