C18H27BrN2O — CID 123940447
3-(bromomethyl)-N-(3-methyl-1-piperidin-1-ylbutan-2-yl)benzamide (PubChem CID 123940447) has the molecular formula C18H27BrN2O and a molecular weight of 367.33 g/mol. Its IUPAC name is 3-(bromomethyl)-N-(3-methyl-1-piperidin-1-ylbutan-2-yl)benzamide.
| Compound Name | 3-(bromomethyl)-N-(3-methyl-1-piperidin-1-ylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 123940447 |
| Molecular Formula | C18H27BrN2O |
| Molecular Weight | 367.33 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 3-(bromomethyl)-N-(3-methyl-1-piperidin-1-ylbutan-2-yl)benzamide |
| SMILES | CC(C)C(CN1CCCCC1)NC(=O)c1cccc(CBr)c1 |
| InChI | InChI=1S/C18H27BrN2O/c1-14(2)17(13-21-9-4-3-5-10-21)20-18(22)16-8-6-7-15(11-16)12-19/h6-8,11,14,17H,3-5,9-10,12-13H2,1-2H3,(H,20,22) |
| InChIKey | TYRTVHMIHUTQLL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|