C20H18N4O3S — CID 123915350
2-[N-amino-N'-[[5-(9H-carbazol-3-yl)furan-2-yl]methyl]carbamimidoyl]sulfanylacetic acid (PubChem CID 123915350) has the molecular formula C20H18N4O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is 2-[N-amino-N'-[[5-(9H-carbazol-3-yl)furan-2-yl]methyl]carbamimidoyl]sulfanylacetic acid.
| Compound Name | 2-[N-amino-N'-[[5-(9H-carbazol-3-yl)furan-2-yl]methyl]carbamimidoyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 123915350 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-[N-amino-N'-[[5-(9H-carbazol-3-yl)furan-2-yl]methyl]carbamimidoyl]sulfanylacetic acid |
| SMILES | NN/C(=N/Cc1ccc(-c2ccc3[nH]c4ccccc4c3c2)o1)SCC(=O)O |
| InChI | InChI=1S/C20H18N4O3S/c21-24-20(28-11-19(25)26)22-10-13-6-8-18(27-13)12-5-7-17-15(9-12)14-3-1-2-4-16(14)23-17/h1-9,23H,10-11,21H2,(H,22,24)(H,25,26) |
| InChIKey | OSYFIPXQIBRMSF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 116.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|