C16H19NO5 — CID 123915902
(Z,2S)-7-oxo-2-(phenylmethoxycarbonylamino)oct-4-enoic acid (PubChem CID 123915902) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is (Z,2S)-7-oxo-2-(phenylmethoxycarbonylamino)oct-4-enoic acid.
| Compound Name | (Z,2S)-7-oxo-2-(phenylmethoxycarbonylamino)oct-4-enoic acid |
|---|---|
| PubChem CID | 123915902 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (Z,2S)-7-oxo-2-(phenylmethoxycarbonylamino)oct-4-enoic acid |
| SMILES | CC(=O)C/C=C\C[C@H](NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H19NO5/c1-12(18)7-5-6-10-14(15(19)20)17-16(21)22-11-13-8-3-2-4-9-13/h2-6,8-9,14H,7,10-11H2,1H3,(H,17,21)(H,19,20)/b6-5-/t14-/m0/s1 |
| InChIKey | UZAFFFGMCRWBDT-GXMNPTEKSA-N |
| XLogP | 2.29 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|