C14H15NO6 — CID 11358319
(E,5S)-5-(phenylmethoxycarbonylamino)hex-2-enedioic acid (PubChem CID 11358319) has the molecular formula C14H15NO6 and a molecular weight of 293.27 g/mol. Its IUPAC name is (E,5S)-5-(phenylmethoxycarbonylamino)hex-2-enedioic acid.
| Compound Name | (E,5S)-5-(phenylmethoxycarbonylamino)hex-2-enedioic acid |
|---|---|
| PubChem CID | 11358319 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | (E,5S)-5-(phenylmethoxycarbonylamino)hex-2-enedioic acid |
| SMILES | O=C(O)/C=C/C[C@H](NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H15NO6/c16-12(17)8-4-7-11(13(18)19)15-14(20)21-9-10-5-2-1-3-6-10/h1-6,8,11H,7,9H2,(H,15,20)(H,16,17)(H,18,19)/b8-4+/t11-/m0/s1 |
| InChIKey | GNIOEAOYYJLDSQ-VUQUXZKVSA-N |
| XLogP | 1.40 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|