C23H21F2NOS2 — CID 123916761
N-(3,4-dimethylphenyl)-3,3-bis[(4-fluorophenyl)sulfanyl]propanamide (PubChem CID 123916761) has the molecular formula C23H21F2NOS2 and a molecular weight of 429.56 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-3,3-bis[(4-fluorophenyl)sulfanyl]propanamide.
| Compound Name | N-(3,4-dimethylphenyl)-3,3-bis[(4-fluorophenyl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 123916761 |
| Molecular Formula | C23H21F2NOS2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | N-(3,4-dimethylphenyl)-3,3-bis[(4-fluorophenyl)sulfanyl]propanamide |
| SMILES | Cc1ccc(NC(=O)CC(Sc2ccc(F)cc2)Sc2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C23H21F2NOS2/c1-15-3-8-19(13-16(15)2)26-22(27)14-23(28-20-9-4-17(24)5-10-20)29-21-11-6-18(25)7-12-21/h3-13,23H,14H2,1-2H3,(H,26,27) |
| InChIKey | WGVJXBWZZTYMJH-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|