C18H31N — CID 123916826
2-butan-2-yl-3,4,6,7-tetramethyl-4,5,6,7,8,9-hexahydro-3H-cyclohepta[b]pyridine (PubChem CID 123916826) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 2-butan-2-yl-3,4,6,7-tetramethyl-4,5,6,7,8,9-hexahydro-3H-cyclohepta[b]pyridine.
| Compound Name | 2-butan-2-yl-3,4,6,7-tetramethyl-4,5,6,7,8,9-hexahydro-3H-cyclohepta[b]pyridine |
|---|---|
| PubChem CID | 123916826 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 2-butan-2-yl-3,4,6,7-tetramethyl-4,5,6,7,8,9-hexahydro-3H-cyclohepta[b]pyridine |
| SMILES | CCC(C)C1=NC2=C(CC(C)C(C)CC2)C(C)C1C |
| InChI | InChI=1S/C18H31N/c1-7-11(2)18-15(6)14(5)16-10-13(4)12(3)8-9-17(16)19-18/h11-15H,7-10H2,1-6H3 |
| InChIKey | POKLVEPEASWBMO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |