C10H17N — CID 72655828
2,3,4,5,6-pentamethyl-3,4-dihydropyridine (PubChem CID 72655828) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethyl-3,4-dihydropyridine.
| Compound Name | 2,3,4,5,6-pentamethyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 72655828 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 2,3,4,5,6-pentamethyl-3,4-dihydropyridine |
| SMILES | CC1=NC(C)=C(C)C(C)C1C |
| InChI | InChI=1S/C10H17N/c1-6-7(2)9(4)11-10(5)8(6)3/h6-7H,1-5H3 |
| InChIKey | IAGCNTUJJNGFER-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |