C12H21N — CID 58108493
2,3,3,4,4,5,6-heptamethylpyridine (PubChem CID 58108493) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 2,3,3,4,4,5,6-heptamethylpyridine.
| Compound Name | 2,3,3,4,4,5,6-heptamethylpyridine |
|---|---|
| PubChem CID | 58108493 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 2,3,3,4,4,5,6-heptamethylpyridine |
| SMILES | CC1=NC(C)=C(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C12H21N/c1-8-9(2)13-10(3)12(6,7)11(8,4)5/h1-7H3 |
| InChIKey | FADGCNONGPCIOH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |