C13H23N — CID 59636879
4,5-ditert-butyl-2-methyl-3H-pyrrole (PubChem CID 59636879) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 4,5-ditert-butyl-2-methyl-3H-pyrrole.
| Compound Name | 4,5-ditert-butyl-2-methyl-3H-pyrrole |
|---|---|
| PubChem CID | 59636879 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 4,5-ditert-butyl-2-methyl-3H-pyrrole |
| SMILES | CC1=NC(C(C)(C)C)=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C13H23N/c1-9-8-10(12(2,3)4)11(14-9)13(5,6)7/h8H2,1-7H3 |
| InChIKey | OUHDFOKTMMYMMC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |