C8H13N — CID 20765952
4-ethyl-2,5-dimethyl-3H-pyrrole (PubChem CID 20765952) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is 4-ethyl-2,5-dimethyl-3H-pyrrole.
| Compound Name | 4-ethyl-2,5-dimethyl-3H-pyrrole |
|---|---|
| PubChem CID | 20765952 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 4-ethyl-2,5-dimethyl-3H-pyrrole |
| SMILES | CCC1=C(C)N=C(C)C1 |
| InChI | InChI=1S/C8H13N/c1-4-8-5-6(2)9-7(8)3/h4-5H2,1-3H3 |
| InChIKey | NGTUNSQWHBYJRB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |