About 2,5,6-trimethyl-3,4-dihydrocyclopenta[b]pyrrole
2,5,6-trimethyl-3,4-dihydrocyclopenta[b]pyrrole (PubChem CID 20647158) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 2,5,6-trimethyl-3,4-dihydrocyclopenta[b]pyrrole.
Analyze 2,5,6-trimethyl-3,4-dihydrocyclopenta[b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5,6-trimethyl-3,4-dihydrocyclopenta[b]pyrrole?
The IUPAC name of 2,5,6-trimethyl-3,4-dihydrocyclopenta[b]pyrrole (CID 20647158) is 2,5,6-trimethyl-3,4-dihydrocyclopenta[b]pyrrole.
What is the SMILES notation for 2,5,6-trimethyl-3,4-dihydrocyclopenta[b]pyrrole?
The canonical SMILES for 2,5,6-trimethyl-3,4-dihydrocyclopenta[b]pyrrole is CC1=NC2=C(C1)CC(C)=C2C.
What is the InChIKey of 2,5,6-trimethyl-3,4-dihydrocyclopenta[b]pyrrole?
The InChIKey is IXNIYCAYPLOYQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-6-4-9-5-7(2)11-10(9)8(6)3/h4-5H2,1-3H3.
What are the key properties of 2,5,6-trimethyl-3,4-dihydrocyclopenta[b]pyrrole?
2,5,6-trimethyl-3,4-dihydrocyclopenta[b]pyrrole has a molecular weight of 147.22 g/mol, XLogP of 2.85, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5,6-trimethyl-3,4-dihydrocyclopenta[b]pyrrole is sourced from PubChem (CID 20647158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).