C10H18N+ — CID 21043311
1,2,3,3,4,5-hexamethylpyrrol-1-ium (PubChem CID 21043311) has the molecular formula C10H18N+ and a molecular weight of 152.26 g/mol. Its IUPAC name is 1,2,3,3,4,5-hexamethylpyrrol-1-ium.
| Compound Name | 1,2,3,3,4,5-hexamethylpyrrol-1-ium |
|---|---|
| PubChem CID | 21043311 |
| Molecular Formula | C10H18N+ |
| Molecular Weight | 152.26 g/mol |
| Exact Mass | 152.14 |
| IUPAC Name | 1,2,3,3,4,5-hexamethylpyrrol-1-ium |
| SMILES | CC1=C(C)C(C)(C)C(C)=[N+]1C |
| InChI | InChI=1S/C10H18N/c1-7-8(2)11(6)9(3)10(7,4)5/h1-6H3/q+1 |
| InChIKey | SLFNVIUWQXNHHR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|