C9H16MtN- — CID 59085074
carbanide;meitnerium;2,3,4,5-tetramethyl-3H-pyrrole (PubChem CID 59085074) has the molecular formula C9H16MtN- and a molecular weight of 416.23 g/mol. Its IUPAC name is carbanide;meitnerium;2,3,4,5-tetramethyl-3H-pyrrole.
| Compound Name | carbanide;meitnerium;2,3,4,5-tetramethyl-3H-pyrrole |
|---|---|
| PubChem CID | 59085074 |
| Molecular Formula | C9H16MtN- |
| Molecular Weight | 416.23 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | carbanide;meitnerium;2,3,4,5-tetramethyl-3H-pyrrole |
| SMILES | CC1=NC(C)=C(C)C1C.[CH3-].[Mt] |
| InChI | InChI=1S/C8H13N.CH3.Mt/c1-5-6(2)8(4)9-7(5)3;;/h5H,1-4H3;1H3;/q;-1; |
| InChIKey | VBDLHNCOLVWEAJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.23 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|