C11H22F6NP — CID 159648092
1,2,3,3,4,5-hexamethylpyrrol-1-ium;methane;hexafluorophosphate (PubChem CID 159648092) has the molecular formula C11H22F6NP and a molecular weight of 313.27 g/mol. Its IUPAC name is 1,2,3,3,4,5-hexamethylpyrrol-1-ium;methane;hexafluorophosphate.
| Compound Name | 1,2,3,3,4,5-hexamethylpyrrol-1-ium;methane;hexafluorophosphate |
|---|---|
| PubChem CID | 159648092 |
| Molecular Formula | C11H22F6NP |
| Molecular Weight | 313.27 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1,2,3,3,4,5-hexamethylpyrrol-1-ium;methane;hexafluorophosphate |
| SMILES | C.CC1=C(C)C(C)(C)C(C)=[N+]1C.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C10H18N.CH4.F6P/c1-7-8(2)11(6)9(3)10(7,4)5;;1-7(2,3,4,5)6/h1-6H3;1H4;/q+1;;-1 |
| InChIKey | HHROYANOENBYFH-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.27 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|