C12H20NRu — CID 58746480
2-(2,4-dimethylpentan-2-yl)-5-methyl-3,4-dihydropyrrol-4-ide;ruthenium(1+) (PubChem CID 58746480) has the molecular formula C12H20NRu and a molecular weight of 279.37 g/mol. Its IUPAC name is 2-(2,4-dimethylpentan-2-yl)-5-methyl-3,4-dihydropyrrol-4-ide;ruthenium(1+).
| Compound Name | 2-(2,4-dimethylpentan-2-yl)-5-methyl-3,4-dihydropyrrol-4-ide;ruthenium(1+) |
|---|---|
| PubChem CID | 58746480 |
| Molecular Formula | C12H20NRu |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 2-(2,4-dimethylpentan-2-yl)-5-methyl-3,4-dihydropyrrol-4-ide;ruthenium(1+) |
| SMILES | CC1=[C-]CC(C(C)(C)CC(C)C)=N1.[Ru+] |
| InChI | InChI=1S/C12H20N.Ru/c1-9(2)8-12(4,5)11-7-6-10(3)13-11;/h9H,7-8H2,1-5H3;/q-1;+1 |
| InChIKey | DLXIDBUFZRIDQG-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|