C10H17N — CID 163258787
5,6-dimethyl-2-propan-2-yl-3,4-dihydropyridine (PubChem CID 163258787) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 5,6-dimethyl-2-propan-2-yl-3,4-dihydropyridine.
| Compound Name | 5,6-dimethyl-2-propan-2-yl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 163258787 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 5,6-dimethyl-2-propan-2-yl-3,4-dihydropyridine |
| SMILES | CC1=C(C)N=C(C(C)C)CC1 |
| InChI | InChI=1S/C10H17N/c1-7(2)10-6-5-8(3)9(4)11-10/h7H,5-6H2,1-4H3 |
| InChIKey | NIUDQIKXUMPUBA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |