C16H22N2 — CID 58315943
2,6-di(propan-2-yl)-3,4,7,8-tetrahydropyrrolo[2,3-f]indole (PubChem CID 58315943) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2,6-di(propan-2-yl)-3,4,7,8-tetrahydropyrrolo[2,3-f]indole.
| Compound Name | 2,6-di(propan-2-yl)-3,4,7,8-tetrahydropyrrolo[2,3-f]indole |
|---|---|
| PubChem CID | 58315943 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 2,6-di(propan-2-yl)-3,4,7,8-tetrahydropyrrolo[2,3-f]indole |
| SMILES | CC(C)C1=NC2=C(C1)CC1=C(CC(C(C)C)=N1)C2 |
| InChI | InChI=1S/C16H22N2/c1-9(2)13-5-11-7-16-12(8-15(11)17-13)6-14(18-16)10(3)4/h9-10H,5-8H2,1-4H3 |
| InChIKey | LGUUATMRTBBDFL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |