C15H27N — CID 146956504
4,5-ditert-butyl-2-(2-tritiopropan-2-yl)-3H-pyrrole (PubChem CID 146956504) has the molecular formula C15H27N and a molecular weight of 223.40 g/mol. Its IUPAC name is 4,5-ditert-butyl-2-(2-tritiopropan-2-yl)-3H-pyrrole.
| Compound Name | 4,5-ditert-butyl-2-(2-tritiopropan-2-yl)-3H-pyrrole |
|---|---|
| PubChem CID | 146956504 |
| Molecular Formula | C15H27N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.22 |
| IUPAC Name | 4,5-ditert-butyl-2-(2-tritiopropan-2-yl)-3H-pyrrole |
| SMILES | [3H]C(C)(C)C1=NC(C(C)(C)C)=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C15H27N/c1-10(2)12-9-11(14(3,4)5)13(16-12)15(6,7)8/h10H,9H2,1-8H3/i10T |
| InChIKey | AJSZDTNDYDZTBS-OAWTUDSLSA-N |
| XLogP | 4.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |