C12H24N2O2 — CID 123916834
[1-(methylamino)-3-(1-methylcyclohexyl)propan-2-yl]carbamic acid (PubChem CID 123916834) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is [1-(methylamino)-3-(1-methylcyclohexyl)propan-2-yl]carbamic acid.
| Compound Name | [1-(methylamino)-3-(1-methylcyclohexyl)propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 123916834 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | [1-(methylamino)-3-(1-methylcyclohexyl)propan-2-yl]carbamic acid |
| SMILES | CNCC(CC1(C)CCCCC1)NC(=O)O |
| InChI | InChI=1S/C12H24N2O2/c1-12(6-4-3-5-7-12)8-10(9-13-2)14-11(15)16/h10,13-14H,3-9H2,1-2H3,(H,15,16) |
| InChIKey | MPQSWIRBDHZHOK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |