C17H20F3N6+ — CID 123919185
1,2,8-trimethyl-5-piperazin-1-yl-9-(trifluoromethyl)-[1,2,4]triazolo[1,5-c]quinazolin-1-ium (PubChem CID 123919185) has the molecular formula C17H20F3N6+ and a molecular weight of 365.38 g/mol. Its IUPAC name is 1,2,8-trimethyl-5-piperazin-1-yl-9-(trifluoromethyl)-[1,2,4]triazolo[1,5-c]quinazolin-1-ium.
| Compound Name | 1,2,8-trimethyl-5-piperazin-1-yl-9-(trifluoromethyl)-[1,2,4]triazolo[1,5-c]quinazolin-1-ium |
|---|---|
| PubChem CID | 123919185 |
| Molecular Formula | C17H20F3N6+ |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1,2,8-trimethyl-5-piperazin-1-yl-9-(trifluoromethyl)-[1,2,4]triazolo[1,5-c]quinazolin-1-ium |
| SMILES | Cc1cc2nc(N3CCNCC3)n3nc(C)[n+](C)c3c2cc1C(F)(F)F |
| InChI | InChI=1S/C17H20F3N6/c1-10-8-14-12(9-13(10)17(18,19)20)15-24(3)11(2)23-26(15)16(22-14)25-6-4-21-5-7-25/h8-9,21H,4-7H2,1-3H3/q+1 |
| InChIKey | PFHIZSYIZKVTCV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 49.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|