C30H30N4O3 — CID 123920364
3-[[4-(4-methylpiperazine-1-carbonyl)phenyl]methylidene]-2-oxo-N-[(1R)-1-phenylethyl]-1H-indole-5-carboxamide (PubChem CID 123920364) has the molecular formula C30H30N4O3 and a molecular weight of 494.60 g/mol. Its IUPAC name is 3-[[4-(4-methylpiperazine-1-carbonyl)phenyl]methylidene]-2-oxo-N-[(1R)-1-phenylethyl]-1H-indole-5-carboxamide.
| Compound Name | 3-[[4-(4-methylpiperazine-1-carbonyl)phenyl]methylidene]-2-oxo-N-[(1R)-1-phenylethyl]-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 123920364 |
| Molecular Formula | C30H30N4O3 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | 3-[[4-(4-methylpiperazine-1-carbonyl)phenyl]methylidene]-2-oxo-N-[(1R)-1-phenylethyl]-1H-indole-5-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2c(c1)C(=Cc1ccc(C(=O)N3CCN(C)CC3)cc1)C(=O)N2)c1ccccc1 |
| InChI | InChI=1S/C30H30N4O3/c1-20(22-6-4-3-5-7-22)31-28(35)24-12-13-27-25(19-24)26(29(36)32-27)18-21-8-10-23(11-9-21)30(37)34-16-14-33(2)15-17-34/h3-13,18-20H,14-17H2,1-2H3,(H,31,35)(H,32,36)/t20-/m1/s1 |
| InChIKey | BORVPWYMBLQZTH-HXUWFJFHSA-N |
| XLogP | 4.06 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|