C26H26N6O3 — CID 68655345
[3-[[4-[4-(4-methylpiperazine-1-carbonyl)phenyl]-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-5-yl]urea (PubChem CID 68655345) has the molecular formula C26H26N6O3 and a molecular weight of 470.53 g/mol. Its IUPAC name is [3-[[4-[4-(4-methylpiperazine-1-carbonyl)phenyl]-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-5-yl]urea.
| Compound Name | [3-[[4-[4-(4-methylpiperazine-1-carbonyl)phenyl]-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-5-yl]urea |
|---|---|
| PubChem CID | 68655345 |
| Molecular Formula | C26H26N6O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | [3-[[4-[4-(4-methylpiperazine-1-carbonyl)phenyl]-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-5-yl]urea |
| SMILES | CN1CCN(C(=O)c2ccc(-c3c[nH]c(C=C4C(=O)Nc5ccc(NC(N)=O)cc54)c3)cc2)CC1 |
| InChI | InChI=1S/C26H26N6O3/c1-31-8-10-32(11-9-31)25(34)17-4-2-16(3-5-17)18-12-20(28-15-18)14-22-21-13-19(29-26(27)35)6-7-23(21)30-24(22)33/h2-7,12-15,28H,8-11H2,1H3,(H,30,33)(H3,27,29,35) |
| InChIKey | VNNHNEHUXOAXCW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|