C22H20N4O4 — CID 68655338
[3-[[4-(3,4-dimethoxyphenyl)-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-5-yl]urea (PubChem CID 68655338) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is [3-[[4-(3,4-dimethoxyphenyl)-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-5-yl]urea.
| Compound Name | [3-[[4-(3,4-dimethoxyphenyl)-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-5-yl]urea |
|---|---|
| PubChem CID | 68655338 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | [3-[[4-(3,4-dimethoxyphenyl)-1H-pyrrol-2-yl]methylidene]-2-oxo-1H-indol-5-yl]urea |
| SMILES | COc1ccc(-c2c[nH]c(C=C3C(=O)Nc4ccc(NC(N)=O)cc43)c2)cc1OC |
| InChI | InChI=1S/C22H20N4O4/c1-29-19-6-3-12(8-20(19)30-2)13-7-15(24-11-13)10-17-16-9-14(25-22(23)28)4-5-18(16)26-21(17)27/h3-11,24H,1-2H3,(H,26,27)(H3,23,25,28) |
| InChIKey | YOEZIIYAGJPLAW-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|