C19H25ClN6S — CID 123920773
8-[6-amino-5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]-8-azaspiro[4.5]decan-4-amine (PubChem CID 123920773) has the molecular formula C19H25ClN6S and a molecular weight of 404.97 g/mol. Its IUPAC name is 8-[6-amino-5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]-8-azaspiro[4.5]decan-4-amine.
| Compound Name | 8-[6-amino-5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]-8-azaspiro[4.5]decan-4-amine |
|---|---|
| PubChem CID | 123920773 |
| Molecular Formula | C19H25ClN6S |
| Molecular Weight | 404.97 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 8-[6-amino-5-(3-amino-2-chlorophenyl)sulfanylpyrazin-2-yl]-8-azaspiro[4.5]decan-4-amine |
| SMILES | Nc1cccc(Sc2ncc(N3CCC4(CCCC4N)CC3)nc2N)c1Cl |
| InChI | InChI=1S/C19H25ClN6S/c20-16-12(21)3-1-4-13(16)27-18-17(23)25-15(11-24-18)26-9-7-19(8-10-26)6-2-5-14(19)22/h1,3-4,11,14H,2,5-10,21-22H2,(H2,23,25) |
| InChIKey | RYQKNCCCQCKZDS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.97 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|