C27H29FN2OSi — CID 123921546
4-[[3-[tert-butyl(diphenyl)silyl]oxyazetidin-1-yl]methyl]-3-fluorobenzonitrile (PubChem CID 123921546) has the molecular formula C27H29FN2OSi and a molecular weight of 444.63 g/mol. Its IUPAC name is 4-[[3-[tert-butyl(diphenyl)silyl]oxyazetidin-1-yl]methyl]-3-fluorobenzonitrile.
| Compound Name | 4-[[3-[tert-butyl(diphenyl)silyl]oxyazetidin-1-yl]methyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 123921546 |
| Molecular Formula | C27H29FN2OSi |
| Molecular Weight | 444.63 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 4-[[3-[tert-butyl(diphenyl)silyl]oxyazetidin-1-yl]methyl]-3-fluorobenzonitrile |
| SMILES | CC(C)(C)[Si](OC1CN(Cc2ccc(C#N)cc2F)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H29FN2OSi/c1-27(2,3)32(24-10-6-4-7-11-24,25-12-8-5-9-13-25)31-23-19-30(20-23)18-22-15-14-21(17-29)16-26(22)28/h4-16,23H,18-20H2,1-3H3 |
| InChIKey | LWYKWKOQWQJADI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.63 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|