C21H32N4O2 — CID 123921823
[4-(3-methylpiperidin-1-yl)piperidin-1-yl]-(6-morpholin-4-yl-3-pyridinyl)methanone (PubChem CID 123921823) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is [4-(3-methylpiperidin-1-yl)piperidin-1-yl]-(6-morpholin-4-yl-3-pyridinyl)methanone.
| Compound Name | [4-(3-methylpiperidin-1-yl)piperidin-1-yl]-(6-morpholin-4-yl-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 123921823 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | [4-(3-methylpiperidin-1-yl)piperidin-1-yl]-(6-morpholin-4-yl-3-pyridinyl)methanone |
| SMILES | CC1CCCN(C2CCN(C(=O)c3ccc(N4CCOCC4)nc3)CC2)C1 |
| InChI | InChI=1S/C21H32N4O2/c1-17-3-2-8-25(16-17)19-6-9-24(10-7-19)21(26)18-4-5-20(22-15-18)23-11-13-27-14-12-23/h4-5,15,17,19H,2-3,6-14,16H2,1H3 |
| InChIKey | QGPCWLRWARTAIT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |