C20H30N4O3 — CID 56758492
[6-(4-hydroxypiperidin-1-yl)-3-pyridinyl]-(4-morpholin-4-ylpiperidin-1-yl)methanone (PubChem CID 56758492) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is [6-(4-hydroxypiperidin-1-yl)-3-pyridinyl]-(4-morpholin-4-ylpiperidin-1-yl)methanone.
| Compound Name | [6-(4-hydroxypiperidin-1-yl)-3-pyridinyl]-(4-morpholin-4-ylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 56758492 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | [6-(4-hydroxypiperidin-1-yl)-3-pyridinyl]-(4-morpholin-4-ylpiperidin-1-yl)methanone |
| SMILES | O=C(c1ccc(N2CCC(O)CC2)nc1)N1CCC(N2CCOCC2)CC1 |
| InChI | InChI=1S/C20H30N4O3/c25-18-5-9-23(10-6-18)19-2-1-16(15-21-19)20(26)24-7-3-17(4-8-24)22-11-13-27-14-12-22/h1-2,15,17-18,25H,3-14H2 |
| InChIKey | KQAQNEINCKZWFI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |