C21H22N2O4 — CID 123922877
3-(3,4-dimethoxyphenyl)-N-[2-[hydroxy-(prop-2-ynylamino)methyl]phenyl]prop-2-enamide (PubChem CID 123922877) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[2-[hydroxy-(prop-2-ynylamino)methyl]phenyl]prop-2-enamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[2-[hydroxy-(prop-2-ynylamino)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 123922877 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[2-[hydroxy-(prop-2-ynylamino)methyl]phenyl]prop-2-enamide |
| SMILES | C#CCNC(O)c1ccccc1NC(=O)C=Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H22N2O4/c1-4-13-22-21(25)16-7-5-6-8-17(16)23-20(24)12-10-15-9-11-18(26-2)19(14-15)27-3/h1,5-12,14,21-22,25H,13H2,2-3H3,(H,23,24) |
| InChIKey | DLSKJTDQSNFLHB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|