C16H18F3N3O2 — CID 123923640
tert-butyl N-[4-(2,2,2-trifluoro-1-pyrazol-1-ylethyl)phenyl]carbamate (PubChem CID 123923640) has the molecular formula C16H18F3N3O2 and a molecular weight of 341.33 g/mol. Its IUPAC name is tert-butyl N-[4-(2,2,2-trifluoro-1-pyrazol-1-ylethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[4-(2,2,2-trifluoro-1-pyrazol-1-ylethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 123923640 |
| Molecular Formula | C16H18F3N3O2 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | tert-butyl N-[4-(2,2,2-trifluoro-1-pyrazol-1-ylethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(n2cccn2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H18F3N3O2/c1-15(2,3)24-14(23)21-12-7-5-11(6-8-12)13(16(17,18)19)22-10-4-9-20-22/h4-10,13H,1-3H3,(H,21,23) |
| InChIKey | KVLZADKJZQJDTI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |