C29H50BrN5O6 — CID 123924091
ethyl 2-[(2-amino-5-bromo-3-pyridinyl)methyl-(3-morpholin-4-ylpropyl)amino]acetate;ethyl 6-morpholin-4-ylhexanoate (PubChem CID 123924091) has the molecular formula C29H50BrN5O6 and a molecular weight of 644.65 g/mol. Its IUPAC name is ethyl 2-[(2-amino-5-bromo-3-pyridinyl)methyl-(3-morpholin-4-ylpropyl)amino]acetate;ethyl 6-morpholin-4-ylhexanoate.
| Compound Name | ethyl 2-[(2-amino-5-bromo-3-pyridinyl)methyl-(3-morpholin-4-ylpropyl)amino]acetate;ethyl 6-morpholin-4-ylhexanoate |
|---|---|
| PubChem CID | 123924091 |
| Molecular Formula | C29H50BrN5O6 |
| Molecular Weight | 644.65 g/mol |
| Exact Mass | 643.29 |
| IUPAC Name | ethyl 2-[(2-amino-5-bromo-3-pyridinyl)methyl-(3-morpholin-4-ylpropyl)amino]acetate;ethyl 6-morpholin-4-ylhexanoate |
| SMILES | CCOC(=O)CCCCCN1CCOCC1.CCOC(=O)CN(CCCN1CCOCC1)Cc1cc(Br)cnc1N |
| InChI | InChI=1S/C17H27BrN4O3.C12H23NO3/c1-2-25-16(23)13-22(5-3-4-21-6-8-24-9-7-21)12-14-10-15(18)11-20-17(14)19;1-2-16-12(14)6-4-3-5-7-13-8-10-15-11-9-13/h10-11H,2-9,12-13H2,1H3,(H2,19,20);2-11H2,1H3 |
| InChIKey | ACYXFAQWENGNPI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.65 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|