C22H27N7O4 — CID 123926016
14-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-2,10-dimethyl-4,7-dioxa-2,10,13,15-tetrazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-9-one (PubChem CID 123926016) has the molecular formula C22H27N7O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is 14-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-2,10-dimethyl-4,7-dioxa-2,10,13,15-tetrazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-9-one.
| Compound Name | 14-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-2,10-dimethyl-4,7-dioxa-2,10,13,15-tetrazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-9-one |
|---|---|
| PubChem CID | 123926016 |
| Molecular Formula | C22H27N7O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 14-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-2,10-dimethyl-4,7-dioxa-2,10,13,15-tetrazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-9-one |
| SMILES | COc1cc(Nc2ncc3c(n2)N(C)COCCOCC(=O)N3C)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C22H27N7O4/c1-15-11-29(13-24-15)17-6-5-16(9-19(17)31-4)25-22-23-10-18-21(26-22)27(2)14-33-8-7-32-12-20(30)28(18)3/h5-6,9-11,13H,7-8,12,14H2,1-4H3,(H,23,25,26) |
| InChIKey | KJNMXELEVUHVLI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |