C23H27N7O3 — CID 138652397
(6aR)-4-ethyl-2-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-5-methyl-6a,7,9,10-tetrahydro-[1,4]oxazino[3,4-h]pteridin-6-one (PubChem CID 138652397) has the molecular formula C23H27N7O3 and a molecular weight of 449.52 g/mol. Its IUPAC name is (6aR)-4-ethyl-2-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-5-methyl-6a,7,9,10-tetrahydro-[1,4]oxazino[3,4-h]pteridin-6-one.
| Compound Name | (6aR)-4-ethyl-2-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-5-methyl-6a,7,9,10-tetrahydro-[1,4]oxazino[3,4-h]pteridin-6-one |
|---|---|
| PubChem CID | 138652397 |
| Molecular Formula | C23H27N7O3 |
| Molecular Weight | 449.52 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | (6aR)-4-ethyl-2-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-5-methyl-6a,7,9,10-tetrahydro-[1,4]oxazino[3,4-h]pteridin-6-one |
| SMILES | CCc1nc(Nc2ccc(-n3cnc(C)c3)c(OC)c2)nc2c1N(C)C(=O)[C@H]1COCCN21 |
| InChI | InChI=1S/C23H27N7O3/c1-5-16-20-21(30-8-9-33-12-18(30)22(31)28(20)3)27-23(26-16)25-15-6-7-17(19(10-15)32-4)29-11-14(2)24-13-29/h6-7,10-11,13,18H,5,8-9,12H2,1-4H3,(H,25,26,27)/t18-/m1/s1 |
| InChIKey | YRUUSNDZMSSRPX-GOSISDBHSA-N |
| XLogP | 2.47 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |