C25H31N7O4 — CID 138653270
4-ethyl-8-hydroxy-5-(2-methoxyethyl)-2-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-6a,7,8,9-tetrahydropyrrolo[2,1-h]pteridin-6-one (PubChem CID 138653270) has the molecular formula C25H31N7O4 and a molecular weight of 493.57 g/mol. Its IUPAC name is 4-ethyl-8-hydroxy-5-(2-methoxyethyl)-2-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-6a,7,8,9-tetrahydropyrrolo[2,1-h]pteridin-6-one.
| Compound Name | 4-ethyl-8-hydroxy-5-(2-methoxyethyl)-2-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-6a,7,8,9-tetrahydropyrrolo[2,1-h]pteridin-6-one |
|---|---|
| PubChem CID | 138653270 |
| Molecular Formula | C25H31N7O4 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 4-ethyl-8-hydroxy-5-(2-methoxyethyl)-2-[3-methoxy-4-(4-methylimidazol-1-yl)anilino]-6a,7,8,9-tetrahydropyrrolo[2,1-h]pteridin-6-one |
| SMILES | CCc1nc(Nc2ccc(-n3cnc(C)c3)c(OC)c2)nc2c1N(CCOC)C(=O)C1CC(O)CN21 |
| InChI | InChI=1S/C25H31N7O4/c1-5-18-22-23(32-13-17(33)11-20(32)24(34)31(22)8-9-35-3)29-25(28-18)27-16-6-7-19(21(10-16)36-4)30-12-15(2)26-14-30/h6-7,10,12,14,17,20,33H,5,8-9,11,13H2,1-4H3,(H,27,28,29) |
| InChIKey | ZMZNTQGWIXDXRZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |