C24H29N7O2 — CID 138652354
4-ethyl-2-[3-ethyl-4-(4-methylimidazol-1-yl)anilino]-5-methyl-6a,7,9,10-tetrahydro-[1,4]oxazino[3,4-h]pteridin-6-one (PubChem CID 138652354) has the molecular formula C24H29N7O2 and a molecular weight of 447.54 g/mol. Its IUPAC name is 4-ethyl-2-[3-ethyl-4-(4-methylimidazol-1-yl)anilino]-5-methyl-6a,7,9,10-tetrahydro-[1,4]oxazino[3,4-h]pteridin-6-one.
| Compound Name | 4-ethyl-2-[3-ethyl-4-(4-methylimidazol-1-yl)anilino]-5-methyl-6a,7,9,10-tetrahydro-[1,4]oxazino[3,4-h]pteridin-6-one |
|---|---|
| PubChem CID | 138652354 |
| Molecular Formula | C24H29N7O2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 4-ethyl-2-[3-ethyl-4-(4-methylimidazol-1-yl)anilino]-5-methyl-6a,7,9,10-tetrahydro-[1,4]oxazino[3,4-h]pteridin-6-one |
| SMILES | CCc1cc(Nc2nc(CC)c3c(n2)N2CCOCC2C(=O)N3C)ccc1-n1cnc(C)c1 |
| InChI | InChI=1S/C24H29N7O2/c1-5-16-11-17(7-8-19(16)30-12-15(3)25-14-30)26-24-27-18(6-2)21-22(28-24)31-9-10-33-13-20(31)23(32)29(21)4/h7-8,11-12,14,20H,5-6,9-10,13H2,1-4H3,(H,26,27,28) |
| InChIKey | YIASKPRACZHMQE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |