C17H25N5O3S — CID 123927090
3-imino-3-[1-[2-(methanesulfonamido)-5-methylbenzoyl]piperidin-2-yl]propanimidamide (PubChem CID 123927090) has the molecular formula C17H25N5O3S and a molecular weight of 379.49 g/mol. Its IUPAC name is 3-imino-3-[1-[2-(methanesulfonamido)-5-methylbenzoyl]piperidin-2-yl]propanimidamide.
| Compound Name | 3-imino-3-[1-[2-(methanesulfonamido)-5-methylbenzoyl]piperidin-2-yl]propanimidamide |
|---|---|
| PubChem CID | 123927090 |
| Molecular Formula | C17H25N5O3S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 3-imino-3-[1-[2-(methanesulfonamido)-5-methylbenzoyl]piperidin-2-yl]propanimidamide |
| SMILES | [H]/N=C(\N)C/C(=N\[H])C1CCCCN1C(=O)c1cc(C)ccc1NS(C)(=O)=O |
| InChI | InChI=1S/C17H25N5O3S/c1-11-6-7-14(21-26(2,24)25)12(9-11)17(23)22-8-4-3-5-15(22)13(18)10-16(19)20/h6-7,9,15,18,21H,3-5,8,10H2,1-2H3,(H3,19,20)/b18-13+ |
| InChIKey | YBYMFUNVHFDDMN-QGOAFFKASA-N |
| XLogP | 1.71 |
| TPSA | 140.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|