C24H34O3Si2 — CID 123927676
trimethyl-[2-prop-2-enyl-4-(3-prop-2-enyl-4-trimethylsilyloxyphenoxy)phenoxy]silane (PubChem CID 123927676) has the molecular formula C24H34O3Si2 and a molecular weight of 426.71 g/mol. Its IUPAC name is trimethyl-[2-prop-2-enyl-4-(3-prop-2-enyl-4-trimethylsilyloxyphenoxy)phenoxy]silane.
| Compound Name | trimethyl-[2-prop-2-enyl-4-(3-prop-2-enyl-4-trimethylsilyloxyphenoxy)phenoxy]silane |
|---|---|
| PubChem CID | 123927676 |
| Molecular Formula | C24H34O3Si2 |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | trimethyl-[2-prop-2-enyl-4-(3-prop-2-enyl-4-trimethylsilyloxyphenoxy)phenoxy]silane |
| SMILES | C=CCc1cc(Oc2ccc(O[Si](C)(C)C)c(CC=C)c2)ccc1O[Si](C)(C)C |
| InChI | InChI=1S/C24H34O3Si2/c1-9-11-19-17-21(13-15-23(19)26-28(3,4)5)25-22-14-16-24(27-29(6,7)8)20(18-22)12-10-2/h9-10,13-18H,1-2,11-12H2,3-8H3 |
| InChIKey | RJZDKERZNRDTKW-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|