C29H36N6O4S3 — CID 123928031
3-methoxy-N-[5-[2-[2-[5-[(3-methoxy-2-phenylpropanoyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]-2-(6-methylcyclohexa-2,4-dien-1-yl)propanamide (PubChem CID 123928031) has the molecular formula C29H36N6O4S3 and a molecular weight of 628.85 g/mol. Its IUPAC name is 3-methoxy-N-[5-[2-[2-[5-[(3-methoxy-2-phenylpropanoyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]-2-(6-methylcyclohexa-2,4-dien-1-yl)propanamide.
| Compound Name | 3-methoxy-N-[5-[2-[2-[5-[(3-methoxy-2-phenylpropanoyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]-2-(6-methylcyclohexa-2,4-dien-1-yl)propanamide |
|---|---|
| PubChem CID | 123928031 |
| Molecular Formula | C29H36N6O4S3 |
| Molecular Weight | 628.85 g/mol |
| Exact Mass | 628.20 |
| IUPAC Name | 3-methoxy-N-[5-[2-[2-[5-[(3-methoxy-2-phenylpropanoyl)amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]-2-(6-methylcyclohexa-2,4-dien-1-yl)propanamide |
| SMILES | COCC(C(=O)Nc1nnc(CCSCCc2nnc(NC(=O)C(COC)C3C=CC=CC3C)s2)s1)c1ccccc1 |
| InChI | InChI=1S/C29H36N6O4S3/c1-19-9-7-8-12-21(19)23(18-39-3)27(37)31-29-35-33-25(42-29)14-16-40-15-13-24-32-34-28(41-24)30-26(36)22(17-38-2)20-10-5-4-6-11-20/h4-12,19,21-23H,13-18H2,1-3H3,(H,30,34,36)(H,31,35,37) |
| InChIKey | ZHTGLULAPMMHQA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.85 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|