C28H28N6O7S3 — CID 146189741
[(1S)-2-[[5-[2-[2-[5-[[(2R)-2-acetyloxy-2-hydroxy-2-phenylacetyl]amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxo-1-phenylethyl] acetate (PubChem CID 146189741) has the molecular formula C28H28N6O7S3 and a molecular weight of 656.77 g/mol. Its IUPAC name is [(1S)-2-[[5-[2-[2-[5-[[(2R)-2-acetyloxy-2-hydroxy-2-phenylacetyl]amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxo-1-phenylethyl] acetate.
| Compound Name | [(1S)-2-[[5-[2-[2-[5-[[(2R)-2-acetyloxy-2-hydroxy-2-phenylacetyl]amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxo-1-phenylethyl] acetate |
|---|---|
| PubChem CID | 146189741 |
| Molecular Formula | C28H28N6O7S3 |
| Molecular Weight | 656.77 g/mol |
| Exact Mass | 656.12 |
| IUPAC Name | [(1S)-2-[[5-[2-[2-[5-[[(2R)-2-acetyloxy-2-hydroxy-2-phenylacetyl]amino]-1,3,4-thiadiazol-2-yl]ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxo-1-phenylethyl] acetate |
| SMILES | CC(=O)O[C@H](C(=O)Nc1nnc(CCSCCc2nnc(NC(=O)[C@](O)(OC(C)=O)c3ccccc3)s2)s1)c1ccccc1 |
| InChI | InChI=1S/C28H28N6O7S3/c1-17(35)40-23(19-9-5-3-6-10-19)24(37)29-26-33-31-21(43-26)13-15-42-16-14-22-32-34-27(44-22)30-25(38)28(39,41-18(2)36)20-11-7-4-8-12-20/h3-12,23,39H,13-16H2,1-2H3,(H,29,33,37)(H,30,34,38)/t23-,28+/m0/s1 |
| InChIKey | HOQSSIRHCKYXRC-NEKDWFFYSA-N |
| XLogP | 3.50 |
| TPSA | 182.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.77 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|