About [1-carbamoyl-4-[2-[4-(2,3-dihydro-1-benzofuran-4-yl)piperidin-1-yl]ethyl]cyclohexyl] pentanoate
[1-carbamoyl-4-[2-[4-(2,3-dihydro-1-benzofuran-4-yl)piperidin-1-yl]ethyl]cyclohexyl] pentanoate (PubChem CID 123928811) has the molecular formula C27H40N2O4
and a molecular weight of 456.63 g/mol. Its IUPAC name is [1-carbamoyl-4-[2-[4-(2,3-dihydro-1-benzofuran-4-yl)piperidin-1-yl]ethyl]cyclohexyl] pentanoate.
Molecular Properties
| Compound Name | [1-carbamoyl-4-[2-[4-(2,3-dihydro-1-benzofuran-4-yl)piperidin-1-yl]ethyl]cyclohexyl] pentanoate |
| PubChem CID | 123928811 |
| Molecular Formula | C27H40N2O4 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | [1-carbamoyl-4-[2-[4-(2,3-dihydro-1-benzofuran-4-yl)piperidin-1-yl]ethyl]cyclohexyl] pentanoate |
| SMILES | CCCCC(=O)OC1(C(N)=O)CCC(CCN2CCC(c3cccc4c3CCO4)CC2)CC1 |
| InChI | InChI=1S/C27H40N2O4/c1-2-3-7-25(30)33-27(26(28)31)14-8-20(9-15-27)10-16-29-17-11-21(12-18-29)22-5-4-6-24-23(22)13-19-32-24/h4-6,20-21H,2-3,7-19H2,1H3,(H2,28,31) |
| InChIKey | VKDHAROFOOKOTI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-carbamoyl-4-[2-[4-(2,3-dihydro-1-benzofuran-4-yl)piperidin-1-yl]ethyl]cyclohexyl] pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-carbamoyl-4-[2-[4-(2,3-dihydro-1-benzofuran-4-yl)piperidin-1-yl]ethyl]cyclohexyl] pentanoate?
The IUPAC name of [1-carbamoyl-4-[2-[4-(2,3-dihydro-1-benzofuran-4-yl)piperidin-1-yl]ethyl]cyclohexyl] pentanoate (CID 123928811) is [1-carbamoyl-4-[2-[4-(2,3-dihydro-1-benzofuran-4-yl)piperidin-1-yl]ethyl]cyclohexyl] pentanoate.
What is the SMILES notation for [1-carbamoyl-4-[2-[4-(2,3-dihydro-1-benzofuran-4-yl)piperidin-1-yl]ethyl]cyclohexyl] pentanoate?
The canonical SMILES for [1-carbamoyl-4-[2-[4-(2,3-dihydro-1-benzofuran-4-yl)piperidin-1-yl]ethyl]cyclohexyl] pentanoate is CCCCC(=O)OC1(C(N)=O)CCC(CCN2CCC(c3cccc4c3CCO4)CC2)CC1.
What is the InChIKey of [1-carbamoyl-4-[2-[4-(2,3-dihydro-1-benzofuran-4-yl)piperidin-1-yl]ethyl]cyclohexyl] pentanoate?
The InChIKey is VKDHAROFOOKOTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H40N2O4/c1-2-3-7-25(30)33-27(26(28)31)14-8-20(9-15-27)10-16-29-17-11-21(12-18-29)22-5-4-6-24-23(22)13-19-32-24/h4-6,20-21H,2-3,7-19H2,1H3,(H2,28,31).
What are the key properties of [1-carbamoyl-4-[2-[4-(2,3-dihydro-1-benzofuran-4-yl)piperidin-1-yl]ethyl]cyclohexyl] pentanoate?
[1-carbamoyl-4-[2-[4-(2,3-dihydro-1-benzofuran-4-yl)piperidin-1-yl]ethyl]cyclohexyl] pentanoate has a molecular weight of 456.63 g/mol, XLogP of 4.34, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-carbamoyl-4-[2-[4-(2,3-dihydro-1-benzofuran-4-yl)piperidin-1-yl]ethyl]cyclohexyl] pentanoate is sourced from PubChem (CID 123928811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).