C24H34N2O5S — CID 123556221
[4-[2-[4-(1-benzofuran-3-yl)piperidin-1-yl]ethyl]-1-carbamoylcyclohexyl] ethanesulfonate (PubChem CID 123556221) has the molecular formula C24H34N2O5S and a molecular weight of 462.61 g/mol. Its IUPAC name is [4-[2-[4-(1-benzofuran-3-yl)piperidin-1-yl]ethyl]-1-carbamoylcyclohexyl] ethanesulfonate.
| Compound Name | [4-[2-[4-(1-benzofuran-3-yl)piperidin-1-yl]ethyl]-1-carbamoylcyclohexyl] ethanesulfonate |
|---|---|
| PubChem CID | 123556221 |
| Molecular Formula | C24H34N2O5S |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | [4-[2-[4-(1-benzofuran-3-yl)piperidin-1-yl]ethyl]-1-carbamoylcyclohexyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)OC1(C(N)=O)CCC(CCN2CCC(c3coc4ccccc34)CC2)CC1 |
| InChI | InChI=1S/C24H34N2O5S/c1-2-32(28,29)31-24(23(25)27)12-7-18(8-13-24)9-14-26-15-10-19(11-16-26)21-17-30-22-6-4-3-5-20(21)22/h3-6,17-19H,2,7-16H2,1H3,(H2,25,27) |
| InChIKey | AIJAFTGQRWVAPQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|