C24H35N3O3 — CID 90806821
[1-carbamoyl-4-[2-(4-phenylpiperazin-1-yl)ethyl]cyclohexyl] 3-methylbut-2-enoate (PubChem CID 90806821) has the molecular formula C24H35N3O3 and a molecular weight of 413.56 g/mol. Its IUPAC name is [1-carbamoyl-4-[2-(4-phenylpiperazin-1-yl)ethyl]cyclohexyl] 3-methylbut-2-enoate.
| Compound Name | [1-carbamoyl-4-[2-(4-phenylpiperazin-1-yl)ethyl]cyclohexyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 90806821 |
| Molecular Formula | C24H35N3O3 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | [1-carbamoyl-4-[2-(4-phenylpiperazin-1-yl)ethyl]cyclohexyl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OC1(C(N)=O)CCC(CCN2CCN(c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C24H35N3O3/c1-19(2)18-22(28)30-24(23(25)29)11-8-20(9-12-24)10-13-26-14-16-27(17-15-26)21-6-4-3-5-7-21/h3-7,18,20H,8-17H2,1-2H3,(H2,25,29) |
| InChIKey | LPJXDGFXDVYODZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|