C25H32F3N3O3 — CID 91183725
[1-carbamoyl-4-[2-[4-(3,4,5-trifluorophenyl)piperazin-1-yl]ethyl]cyclohexyl] cyclopent-3-ene-1-carboxylate (PubChem CID 91183725) has the molecular formula C25H32F3N3O3 and a molecular weight of 479.54 g/mol. Its IUPAC name is [1-carbamoyl-4-[2-[4-(3,4,5-trifluorophenyl)piperazin-1-yl]ethyl]cyclohexyl] cyclopent-3-ene-1-carboxylate.
| Compound Name | [1-carbamoyl-4-[2-[4-(3,4,5-trifluorophenyl)piperazin-1-yl]ethyl]cyclohexyl] cyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 91183725 |
| Molecular Formula | C25H32F3N3O3 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | [1-carbamoyl-4-[2-[4-(3,4,5-trifluorophenyl)piperazin-1-yl]ethyl]cyclohexyl] cyclopent-3-ene-1-carboxylate |
| SMILES | NC(=O)C1(OC(=O)C2CC=CC2)CCC(CCN2CCN(c3cc(F)c(F)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C25H32F3N3O3/c26-20-15-19(16-21(27)22(20)28)31-13-11-30(12-14-31)10-7-17-5-8-25(9-6-17,24(29)33)34-23(32)18-3-1-2-4-18/h1-2,15-18H,3-14H2,(H2,29,33) |
| InChIKey | FJVGUXZAXMOXKF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|