About [4-[2-[4-(3-fluoro-4-sulfamoylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl] 2,2-dimethylpropanoate
[4-[2-[4-(3-fluoro-4-sulfamoylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174545815) has the molecular formula C22H35FN4O4S
and a molecular weight of 470.61 g/mol. Its IUPAC name is [4-[2-[4-(3-fluoro-4-sulfamoylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [4-[2-[4-(3-fluoro-4-sulfamoylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl] 2,2-dimethylpropanoate |
| PubChem CID | 174545815 |
| Molecular Formula | C22H35FN4O4S |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | [4-[2-[4-(3-fluoro-4-sulfamoylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCC(CCN2CCN(c3ccc(S(N)(=O)=O)c(F)c3)CC2)CC1 |
| InChI | InChI=1S/C22H35FN4O4S/c1-22(2,3)21(28)31-27-10-7-17(8-11-27)6-9-25-12-14-26(15-13-25)18-4-5-20(19(23)16-18)32(24,29)30/h4-5,16-17H,6-15H2,1-3H3,(H2,24,29,30) |
| InChIKey | GXQUEEJGFKEIBH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [4-[2-[4-(3-fluoro-4-sulfamoylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[4-(3-fluoro-4-sulfamoylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl] 2,2-dimethylpropanoate?
The IUPAC name of [4-[2-[4-(3-fluoro-4-sulfamoylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl] 2,2-dimethylpropanoate (CID 174545815) is [4-[2-[4-(3-fluoro-4-sulfamoylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl] 2,2-dimethylpropanoate.
What is the SMILES notation for [4-[2-[4-(3-fluoro-4-sulfamoylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl] 2,2-dimethylpropanoate?
The canonical SMILES for [4-[2-[4-(3-fluoro-4-sulfamoylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl] 2,2-dimethylpropanoate is CC(C)(C)C(=O)ON1CCC(CCN2CCN(c3ccc(S(N)(=O)=O)c(F)c3)CC2)CC1.
What is the InChIKey of [4-[2-[4-(3-fluoro-4-sulfamoylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl] 2,2-dimethylpropanoate?
The InChIKey is GXQUEEJGFKEIBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35FN4O4S/c1-22(2,3)21(28)31-27-10-7-17(8-11-27)6-9-25-12-14-26(15-13-25)18-4-5-20(19(23)16-18)32(24,29)30/h4-5,16-17H,6-15H2,1-3H3,(H2,24,29,30).
What are the key properties of [4-[2-[4-(3-fluoro-4-sulfamoylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl] 2,2-dimethylpropanoate?
[4-[2-[4-(3-fluoro-4-sulfamoylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl] 2,2-dimethylpropanoate has a molecular weight of 470.61 g/mol, XLogP of 2.20, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[4-(3-fluoro-4-sulfamoylphenyl)piperazin-1-yl]ethyl]piperidin-1-yl] 2,2-dimethylpropanoate is sourced from PubChem (CID 174545815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).